C21H30N4O — CID 158321054
1-benzyl-5-[4-[[butyl(methyl)amino]methyl]-1H-pyrazol-5-yl]piperidin-2-one (PubChem CID 158321054) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is 1-benzyl-5-[4-[[butyl(methyl)amino]methyl]-1H-pyrazol-5-yl]piperidin-2-one.
| Compound Name | 1-benzyl-5-[4-[[butyl(methyl)amino]methyl]-1H-pyrazol-5-yl]piperidin-2-one |
|---|---|
| PubChem CID | 158321054 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 1-benzyl-5-[4-[[butyl(methyl)amino]methyl]-1H-pyrazol-5-yl]piperidin-2-one |
| SMILES | CCCCN(C)Cc1cn[nH]c1C1CCC(=O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C21H30N4O/c1-3-4-12-24(2)15-19-13-22-23-21(19)18-10-11-20(26)25(16-18)14-17-8-6-5-7-9-17/h5-9,13,18H,3-4,10-12,14-16H2,1-2H3,(H,22,23) |
| InChIKey | GOVVRQXTLQZSEW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |