C22H32N4O — CID 97435583
(6R)-1-benzyl-4-[(5-cyclohexyl-1H-pyrazol-4-yl)methyl]-1,4-diazepan-6-ol (PubChem CID 97435583) has the molecular formula C22H32N4O and a molecular weight of 368.53 g/mol. Its IUPAC name is (6R)-1-benzyl-4-[(5-cyclohexyl-1H-pyrazol-4-yl)methyl]-1,4-diazepan-6-ol.
| Compound Name | (6R)-1-benzyl-4-[(5-cyclohexyl-1H-pyrazol-4-yl)methyl]-1,4-diazepan-6-ol |
|---|---|
| PubChem CID | 97435583 |
| Molecular Formula | C22H32N4O |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | (6R)-1-benzyl-4-[(5-cyclohexyl-1H-pyrazol-4-yl)methyl]-1,4-diazepan-6-ol |
| SMILES | O[C@@H]1CN(Cc2ccccc2)CCN(Cc2cn[nH]c2C2CCCCC2)C1 |
| InChI | InChI=1S/C22H32N4O/c27-21-16-25(14-18-7-3-1-4-8-18)11-12-26(17-21)15-20-13-23-24-22(20)19-9-5-2-6-10-19/h1,3-4,7-8,13,19,21,27H,2,5-6,9-12,14-17H2,(H,23,24)/t21-/m1/s1 |
| InChIKey | JJJUEGRIGURSGA-OAQYLSRUSA-N |
| XLogP | 3.14 |
| TPSA | 55.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |