C21H22Cl2N4 — CID 129132926
4-[[4-(4-benzyl-1H-pyrazol-5-yl)piperidin-1-yl]methyl]-2,3-dichloropyridine (PubChem CID 129132926) has the molecular formula C21H22Cl2N4 and a molecular weight of 401.34 g/mol. Its IUPAC name is 4-[[4-(4-benzyl-1H-pyrazol-5-yl)piperidin-1-yl]methyl]-2,3-dichloropyridine.
| Compound Name | 4-[[4-(4-benzyl-1H-pyrazol-5-yl)piperidin-1-yl]methyl]-2,3-dichloropyridine |
|---|---|
| PubChem CID | 129132926 |
| Molecular Formula | C21H22Cl2N4 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 4-[[4-(4-benzyl-1H-pyrazol-5-yl)piperidin-1-yl]methyl]-2,3-dichloropyridine |
| SMILES | Clc1nccc(CN2CCC(c3[nH]ncc3Cc3ccccc3)CC2)c1Cl |
| InChI | InChI=1S/C21H22Cl2N4/c22-19-17(6-9-24-21(19)23)14-27-10-7-16(8-11-27)20-18(13-25-26-20)12-15-4-2-1-3-5-15/h1-6,9,13,16H,7-8,10-12,14H2,(H,25,26) |
| InChIKey | FAHWBCVOMMNBGV-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|