C21H23ClN4 — CID 118518677
4-[[4-(5-benzyl-1H-pyrazol-4-yl)piperidin-1-yl]methyl]-3-chloropyridine (PubChem CID 118518677) has the molecular formula C21H23ClN4 and a molecular weight of 366.90 g/mol. Its IUPAC name is 4-[[4-(5-benzyl-1H-pyrazol-4-yl)piperidin-1-yl]methyl]-3-chloropyridine.
| Compound Name | 4-[[4-(5-benzyl-1H-pyrazol-4-yl)piperidin-1-yl]methyl]-3-chloropyridine |
|---|---|
| PubChem CID | 118518677 |
| Molecular Formula | C21H23ClN4 |
| Molecular Weight | 366.90 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 4-[[4-(5-benzyl-1H-pyrazol-4-yl)piperidin-1-yl]methyl]-3-chloropyridine |
| SMILES | Clc1cnccc1CN1CCC(c2cn[nH]c2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H23ClN4/c22-20-14-23-9-6-18(20)15-26-10-7-17(8-11-26)19-13-24-25-21(19)12-16-4-2-1-3-5-16/h1-6,9,13-14,17H,7-8,10-12,15H2,(H,24,25) |
| InChIKey | YWLDQQLBFACRDY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.90 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |