C20H24ClN5 — CID 56744086
4-(4-benzyl-1H-pyrazol-5-yl)-1-[(4-chloro-5-methyl-1H-pyrazol-3-yl)methyl]piperidine (PubChem CID 56744086) has the molecular formula C20H24ClN5 and a molecular weight of 369.90 g/mol. Its IUPAC name is 4-(4-benzyl-1H-pyrazol-5-yl)-1-[(4-chloro-5-methyl-1H-pyrazol-3-yl)methyl]piperidine.
| Compound Name | 4-(4-benzyl-1H-pyrazol-5-yl)-1-[(4-chloro-5-methyl-1H-pyrazol-3-yl)methyl]piperidine |
|---|---|
| PubChem CID | 56744086 |
| Molecular Formula | C20H24ClN5 |
| Molecular Weight | 369.90 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 4-(4-benzyl-1H-pyrazol-5-yl)-1-[(4-chloro-5-methyl-1H-pyrazol-3-yl)methyl]piperidine |
| SMILES | Cc1[nH]nc(CN2CCC(c3[nH]ncc3Cc3ccccc3)CC2)c1Cl |
| InChI | InChI=1S/C20H24ClN5/c1-14-19(21)18(24-23-14)13-26-9-7-16(8-10-26)20-17(12-22-25-20)11-15-5-3-2-4-6-15/h2-6,12,16H,7-11,13H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | ATKAZSWRLKXPRU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.90 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |