C24H24N4O — CID 56754434
[4-(4-benzyl-1H-pyrazol-5-yl)piperidin-1-yl]-(1H-indol-3-yl)methanone (PubChem CID 56754434) has the molecular formula C24H24N4O and a molecular weight of 384.48 g/mol. Its IUPAC name is [4-(4-benzyl-1H-pyrazol-5-yl)piperidin-1-yl]-(1H-indol-3-yl)methanone.
| Compound Name | [4-(4-benzyl-1H-pyrazol-5-yl)piperidin-1-yl]-(1H-indol-3-yl)methanone |
|---|---|
| PubChem CID | 56754434 |
| Molecular Formula | C24H24N4O |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | [4-(4-benzyl-1H-pyrazol-5-yl)piperidin-1-yl]-(1H-indol-3-yl)methanone |
| SMILES | O=C(c1c[nH]c2ccccc12)N1CCC(c2[nH]ncc2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H24N4O/c29-24(21-16-25-22-9-5-4-8-20(21)22)28-12-10-18(11-13-28)23-19(15-26-27-23)14-17-6-2-1-3-7-17/h1-9,15-16,18,25H,10-14H2,(H,26,27) |
| InChIKey | HNPKSNNBMLPEEM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 64.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |