C29H32N2O4 — CID 158321739
2-methyl-3-(4-phenylmethoxyphenyl)-2-[2-(piperidine-1-carbonyl)anilino]propanoic acid (PubChem CID 158321739) has the molecular formula C29H32N2O4 and a molecular weight of 472.59 g/mol. Its IUPAC name is 2-methyl-3-(4-phenylmethoxyphenyl)-2-[2-(piperidine-1-carbonyl)anilino]propanoic acid.
| Compound Name | 2-methyl-3-(4-phenylmethoxyphenyl)-2-[2-(piperidine-1-carbonyl)anilino]propanoic acid |
|---|---|
| PubChem CID | 158321739 |
| Molecular Formula | C29H32N2O4 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 2-methyl-3-(4-phenylmethoxyphenyl)-2-[2-(piperidine-1-carbonyl)anilino]propanoic acid |
| SMILES | CC(Cc1ccc(OCc2ccccc2)cc1)(Nc1ccccc1C(=O)N1CCCCC1)C(=O)O |
| InChI | InChI=1S/C29H32N2O4/c1-29(28(33)34,20-22-14-16-24(17-15-22)35-21-23-10-4-2-5-11-23)30-26-13-7-6-12-25(26)27(32)31-18-8-3-9-19-31/h2,4-7,10-17,30H,3,8-9,18-21H2,1H3,(H,33,34) |
| InChIKey | GOXWVAHNFPDSLI-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |