C14H20N2O4S2 — CID 158322724
N-(1-ethylpyrrol-3-yl)-N-methylthiophene-2-sulfonamide;propanoic acid (PubChem CID 158322724) has the molecular formula C14H20N2O4S2 and a molecular weight of 344.46 g/mol. Its IUPAC name is N-(1-ethylpyrrol-3-yl)-N-methylthiophene-2-sulfonamide;propanoic acid.
| Compound Name | N-(1-ethylpyrrol-3-yl)-N-methylthiophene-2-sulfonamide;propanoic acid |
|---|---|
| PubChem CID | 158322724 |
| Molecular Formula | C14H20N2O4S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | N-(1-ethylpyrrol-3-yl)-N-methylthiophene-2-sulfonamide;propanoic acid |
| SMILES | CCC(=O)O.CCn1ccc(N(C)S(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C11H14N2O2S2.C3H6O2/c1-3-13-7-6-10(9-13)12(2)17(14,15)11-5-4-8-16-11;1-2-3(4)5/h4-9H,3H2,1-2H3;2H2,1H3,(H,4,5) |
| InChIKey | GPAVLLIFQXCZBJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |