C17H22N2O3S2 — CID 53283010
4-[methyl(thiophen-2-ylsulfonyl)amino]-N-pentan-3-ylbenzamide (PubChem CID 53283010) has the molecular formula C17H22N2O3S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 4-[methyl(thiophen-2-ylsulfonyl)amino]-N-pentan-3-ylbenzamide.
| Compound Name | 4-[methyl(thiophen-2-ylsulfonyl)amino]-N-pentan-3-ylbenzamide |
|---|---|
| PubChem CID | 53283010 |
| Molecular Formula | C17H22N2O3S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 4-[methyl(thiophen-2-ylsulfonyl)amino]-N-pentan-3-ylbenzamide |
| SMILES | CCC(CC)NC(=O)c1ccc(N(C)S(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C17H22N2O3S2/c1-4-14(5-2)18-17(20)13-8-10-15(11-9-13)19(3)24(21,22)16-7-6-12-23-16/h6-12,14H,4-5H2,1-3H3,(H,18,20) |
| InChIKey | QMFLGGVPPYVBHL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |