C19H17FN2O3S2 — CID 53283027
N-[(3-fluorophenyl)methyl]-4-[methyl(thiophen-2-ylsulfonyl)amino]benzamide (PubChem CID 53283027) has the molecular formula C19H17FN2O3S2 and a molecular weight of 404.49 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-4-[methyl(thiophen-2-ylsulfonyl)amino]benzamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-4-[methyl(thiophen-2-ylsulfonyl)amino]benzamide |
|---|---|
| PubChem CID | 53283027 |
| Molecular Formula | C19H17FN2O3S2 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-4-[methyl(thiophen-2-ylsulfonyl)amino]benzamide |
| SMILES | CN(c1ccc(C(=O)NCc2cccc(F)c2)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C19H17FN2O3S2/c1-22(27(24,25)18-6-3-11-26-18)17-9-7-15(8-10-17)19(23)21-13-14-4-2-5-16(20)12-14/h2-12H,13H2,1H3,(H,21,23) |
| InChIKey | PFDNYTIYBQSBBU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |