C23H25N2+ — CID 158322918
1-methyl-2-(2-methylphenyl)-8-(2-methylpropyl)-9H-indeno[1,2-b]pyrazin-1-ium (PubChem CID 158322918) has the molecular formula C23H25N2+ and a molecular weight of 329.47 g/mol. Its IUPAC name is 1-methyl-2-(2-methylphenyl)-8-(2-methylpropyl)-9H-indeno[1,2-b]pyrazin-1-ium.
| Compound Name | 1-methyl-2-(2-methylphenyl)-8-(2-methylpropyl)-9H-indeno[1,2-b]pyrazin-1-ium |
|---|---|
| PubChem CID | 158322918 |
| Molecular Formula | C23H25N2+ |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 1-methyl-2-(2-methylphenyl)-8-(2-methylpropyl)-9H-indeno[1,2-b]pyrazin-1-ium |
| SMILES | Cc1ccccc1-c1cnc2c([n+]1C)Cc1c(CC(C)C)cccc1-2 |
| InChI | InChI=1S/C23H25N2/c1-15(2)12-17-9-7-11-19-20(17)13-21-23(19)24-14-22(25(21)4)18-10-6-5-8-16(18)3/h5-11,14-15H,12-13H2,1-4H3/q+1 |
| InChIKey | XVPXPQAWNISHBF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|