C24H19ClF4N2O2 — CID 158323479
3-(4-chloro-2-fluorophenyl)-1-[4-[2-(trifluoromethyl)quinolin-4-yl]piperidin-1-yl]propane-1,2-dione (PubChem CID 158323479) has the molecular formula C24H19ClF4N2O2 and a molecular weight of 478.87 g/mol. Its IUPAC name is 3-(4-chloro-2-fluorophenyl)-1-[4-[2-(trifluoromethyl)quinolin-4-yl]piperidin-1-yl]propane-1,2-dione.
| Compound Name | 3-(4-chloro-2-fluorophenyl)-1-[4-[2-(trifluoromethyl)quinolin-4-yl]piperidin-1-yl]propane-1,2-dione |
|---|---|
| PubChem CID | 158323479 |
| Molecular Formula | C24H19ClF4N2O2 |
| Molecular Weight | 478.87 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | 3-(4-chloro-2-fluorophenyl)-1-[4-[2-(trifluoromethyl)quinolin-4-yl]piperidin-1-yl]propane-1,2-dione |
| SMILES | O=C(Cc1ccc(Cl)cc1F)C(=O)N1CCC(c2cc(C(F)(F)F)nc3ccccc23)CC1 |
| InChI | InChI=1S/C24H19ClF4N2O2/c25-16-6-5-15(19(26)12-16)11-21(32)23(33)31-9-7-14(8-10-31)18-13-22(24(27,28)29)30-20-4-2-1-3-17(18)20/h1-6,12-14H,7-11H2 |
| InChIKey | MIOHAWRQTRWICI-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.87 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|