C24H22ClFN2O2 — CID 158335303
3-(4-chlorophenyl)-1-[4-(6-fluoro-8-methylquinolin-4-yl)piperidin-1-yl]propane-1,2-dione (PubChem CID 158335303) has the molecular formula C24H22ClFN2O2 and a molecular weight of 424.90 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[4-(6-fluoro-8-methylquinolin-4-yl)piperidin-1-yl]propane-1,2-dione.
| Compound Name | 3-(4-chlorophenyl)-1-[4-(6-fluoro-8-methylquinolin-4-yl)piperidin-1-yl]propane-1,2-dione |
|---|---|
| PubChem CID | 158335303 |
| Molecular Formula | C24H22ClFN2O2 |
| Molecular Weight | 424.90 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[4-(6-fluoro-8-methylquinolin-4-yl)piperidin-1-yl]propane-1,2-dione |
| SMILES | Cc1cc(F)cc2c(C3CCN(C(=O)C(=O)Cc4ccc(Cl)cc4)CC3)ccnc12 |
| InChI | InChI=1S/C24H22ClFN2O2/c1-15-12-19(26)14-21-20(6-9-27-23(15)21)17-7-10-28(11-8-17)24(30)22(29)13-16-2-4-18(25)5-3-16/h2-6,9,12,14,17H,7-8,10-11,13H2,1H3 |
| InChIKey | KFZPSIHJCBDCTA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.90 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|