C25H31N3O6S — CID 158325207
(cyclobutylamino)methyl [4-[5-[4-(2-methylpropyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methanesulfonate;formic acid (PubChem CID 158325207) has the molecular formula C25H31N3O6S and a molecular weight of 501.61 g/mol. Its IUPAC name is (cyclobutylamino)methyl [4-[5-[4-(2-methylpropyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methanesulfonate;formic acid.
| Compound Name | (cyclobutylamino)methyl [4-[5-[4-(2-methylpropyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methanesulfonate;formic acid |
|---|---|
| PubChem CID | 158325207 |
| Molecular Formula | C25H31N3O6S |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | (cyclobutylamino)methyl [4-[5-[4-(2-methylpropyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methanesulfonate;formic acid |
| SMILES | CC(C)Cc1ccc(-c2nc(-c3ccc(CS(=O)(=O)OCNC4CCC4)cc3)no2)cc1.O=CO |
| InChI | InChI=1S/C24H29N3O4S.CH2O2/c1-17(2)14-18-6-12-21(13-7-18)24-26-23(27-31-24)20-10-8-19(9-11-20)15-32(28,29)30-16-25-22-4-3-5-22;2-1-3/h6-13,17,22,25H,3-5,14-16H2,1-2H3;1H,(H,2,3) |
| InChIKey | GPIACSAXKPATBA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|