C24H27N3O3 — CID 87529920
[3-[[4-[3-[4-(2-methylpropyl)phenyl]-1,2,4-oxadiazol-5-yl]phenyl]methylamino]cyclobutyl] formate (PubChem CID 87529920) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is [3-[[4-[3-[4-(2-methylpropyl)phenyl]-1,2,4-oxadiazol-5-yl]phenyl]methylamino]cyclobutyl] formate.
| Compound Name | [3-[[4-[3-[4-(2-methylpropyl)phenyl]-1,2,4-oxadiazol-5-yl]phenyl]methylamino]cyclobutyl] formate |
|---|---|
| PubChem CID | 87529920 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | [3-[[4-[3-[4-(2-methylpropyl)phenyl]-1,2,4-oxadiazol-5-yl]phenyl]methylamino]cyclobutyl] formate |
| SMILES | CC(C)Cc1ccc(-c2noc(-c3ccc(CNC4CC(OC=O)C4)cc3)n2)cc1 |
| InChI | InChI=1S/C24H27N3O3/c1-16(2)11-17-3-7-19(8-4-17)23-26-24(30-27-23)20-9-5-18(6-10-20)14-25-21-12-22(13-21)29-15-28/h3-10,15-16,21-22,25H,11-14H2,1-2H3 |
| InChIKey | OPYSPPXJUCZTMX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|