C22H22N3O5S- — CID 174570282
1-[4-[3-[4-[[(3-formyloxycyclobutyl)amino]methyl]phenyl]-1,2,4-oxadiazol-5-yl]phenyl]ethanesulfinate (PubChem CID 174570282) has the molecular formula C22H22N3O5S- and a molecular weight of 440.50 g/mol. Its IUPAC name is 1-[4-[3-[4-[[(3-formyloxycyclobutyl)amino]methyl]phenyl]-1,2,4-oxadiazol-5-yl]phenyl]ethanesulfinate.
| Compound Name | 1-[4-[3-[4-[[(3-formyloxycyclobutyl)amino]methyl]phenyl]-1,2,4-oxadiazol-5-yl]phenyl]ethanesulfinate |
|---|---|
| PubChem CID | 174570282 |
| Molecular Formula | C22H22N3O5S- |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 1-[4-[3-[4-[[(3-formyloxycyclobutyl)amino]methyl]phenyl]-1,2,4-oxadiazol-5-yl]phenyl]ethanesulfinate |
| SMILES | CC(c1ccc(-c2nc(-c3ccc(CNC4CC(OC=O)C4)cc3)no2)cc1)S(=O)[O-] |
| InChI | InChI=1S/C22H23N3O5S/c1-14(31(27)28)16-6-8-18(9-7-16)22-24-21(25-30-22)17-4-2-15(3-5-17)12-23-19-10-20(11-19)29-13-26/h2-9,13-14,19-20,23H,10-12H2,1H3,(H,27,28)/p-1 |
| InChIKey | NOFUMLVSFPRLEU-UHFFFAOYSA-M |
| XLogP | 3.14 |
| TPSA | 117.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|