C23H24ClN3O4 — CID 175262724
[3-[[3-chloro-4-[5-(4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methylamino]cyclobutyl] formate (PubChem CID 175262724) has the molecular formula C23H24ClN3O4 and a molecular weight of 441.92 g/mol. Its IUPAC name is [3-[[3-chloro-4-[5-(4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methylamino]cyclobutyl] formate.
| Compound Name | [3-[[3-chloro-4-[5-(4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methylamino]cyclobutyl] formate |
|---|---|
| PubChem CID | 175262724 |
| Molecular Formula | C23H24ClN3O4 |
| Molecular Weight | 441.92 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | [3-[[3-chloro-4-[5-(4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methylamino]cyclobutyl] formate |
| SMILES | CC(C)Oc1ccc(-c2nc(-c3ccc(CNC4CC(OC=O)C4)cc3Cl)no2)cc1 |
| InChI | InChI=1S/C23H24ClN3O4/c1-14(2)30-18-6-4-16(5-7-18)23-26-22(27-31-23)20-8-3-15(9-21(20)24)12-25-17-10-19(11-17)29-13-28/h3-9,13-14,17,19,25H,10-12H2,1-2H3 |
| InChIKey | ZFJDJISAMVLMPN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.92 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|