C22H19ClN2O4 — CID 88568078
3-[4-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1-benzofuran-7-yl]propanal (PubChem CID 88568078) has the molecular formula C22H19ClN2O4 and a molecular weight of 410.86 g/mol. Its IUPAC name is 3-[4-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1-benzofuran-7-yl]propanal.
| Compound Name | 3-[4-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1-benzofuran-7-yl]propanal |
|---|---|
| PubChem CID | 88568078 |
| Molecular Formula | C22H19ClN2O4 |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 3-[4-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1-benzofuran-7-yl]propanal |
| SMILES | CC(C)Oc1ccc(-c2nc(-c3ccc(CCC=O)c4occc34)no2)cc1Cl |
| InChI | InChI=1S/C22H19ClN2O4/c1-13(2)28-19-8-6-15(12-18(19)23)22-24-21(25-29-22)17-7-5-14(4-3-10-26)20-16(17)9-11-27-20/h5-13H,3-4H2,1-2H3 |
| InChIKey | KVHLEQVZRFYDDY-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 78.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|