C22H24ClN3O4 — CID 90801695
ethyl 2-[4-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-3-methylphenoxy]ethanimidate (PubChem CID 90801695) has the molecular formula C22H24ClN3O4 and a molecular weight of 429.90 g/mol. Its IUPAC name is ethyl 2-[4-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-3-methylphenoxy]ethanimidate.
| Compound Name | ethyl 2-[4-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-3-methylphenoxy]ethanimidate |
|---|---|
| PubChem CID | 90801695 |
| Molecular Formula | C22H24ClN3O4 |
| Molecular Weight | 429.90 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | ethyl 2-[4-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-3-methylphenoxy]ethanimidate |
| SMILES | [H]/N=C(/COc1ccc(-c2noc(-c3ccc(OC(C)C)c(Cl)c3)n2)c(C)c1)OCC |
| InChI | InChI=1S/C22H24ClN3O4/c1-5-27-20(24)12-28-16-7-8-17(14(4)10-16)21-25-22(30-26-21)15-6-9-19(18(23)11-15)29-13(2)3/h6-11,13,24H,5,12H2,1-4H3/b24-20- |
| InChIKey | YVXIQKBVXOJTIC-GFMRDNFCSA-N |
| XLogP | 5.55 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.90 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|