C36H51Br3N4O2Si2 — CID 158326283
3-bromo-5-isocyano-1H-indole;3-(3-bromo-5-isocyanoindol-1-yl)propoxy-tert-butyl-dimethylsilane;3-bromopropoxy-tert-butyl-dimethylsilane (PubChem CID 158326283) has the molecular formula C36H51Br3N4O2Si2 and a molecular weight of 867.71 g/mol. Its IUPAC name is 3-bromo-5-isocyano-1H-indole;3-(3-bromo-5-isocyanoindol-1-yl)propoxy-tert-butyl-dimethylsilane;3-bromopropoxy-tert-butyl-dimethylsilane.
| Compound Name | 3-bromo-5-isocyano-1H-indole;3-(3-bromo-5-isocyanoindol-1-yl)propoxy-tert-butyl-dimethylsilane;3-bromopropoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 158326283 |
| Molecular Formula | C36H51Br3N4O2Si2 |
| Molecular Weight | 867.71 g/mol |
| Exact Mass | 864.11 |
| IUPAC Name | 3-bromo-5-isocyano-1H-indole;3-(3-bromo-5-isocyanoindol-1-yl)propoxy-tert-butyl-dimethylsilane;3-bromopropoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCBr.[C-]#[N+]c1ccc2[nH]cc(Br)c2c1.[C-]#[N+]c1ccc2c(c1)c(Br)cn2CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H25BrN2OSi.C9H5BrN2.C9H21BrOSi/c1-18(2,3)23(5,6)22-11-7-10-21-13-16(19)15-12-14(20-4)8-9-17(15)21;1-11-6-2-3-9-7(4-6)8(10)5-12-9;1-9(2,3)12(4,5)11-8-6-7-10/h8-9,12-13H,7,10-11H2,1-3,5-6H3;2-5,12H;6-8H2,1-5H3 |
| InChIKey | GPLGKOVHBNTGEI-UHFFFAOYSA-N |
| XLogP | 13.64 |
| TPSA | 47.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.71 |
| LogP ≤ 5 | 13.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|