About 6-bromo-1-ethylindole;6-bromo-1H-indole
6-bromo-1-ethylindole;6-bromo-1H-indole (PubChem CID 158373742) has the molecular formula C18H16Br2N2
and a molecular weight of 420.15 g/mol. Its IUPAC name is 6-bromo-1-ethylindole;6-bromo-1H-indole.
Molecular Properties
| Compound Name | 6-bromo-1-ethylindole;6-bromo-1H-indole |
| PubChem CID | 158373742 |
| Molecular Formula | C18H16Br2N2 |
| Molecular Weight | 420.15 g/mol |
| Exact Mass | 417.97 |
| IUPAC Name | 6-bromo-1-ethylindole;6-bromo-1H-indole |
| SMILES | Brc1ccc2cc[nH]c2c1.CCn1ccc2ccc(Br)cc21 |
| InChI | InChI=1S/C10H10BrN.C8H6BrN/c1-2-12-6-5-8-3-4-9(11)7-10(8)12;9-7-2-1-6-3-4-10-8(6)5-7/h3-7H,2H2,1H3;1-5,10H |
| InChIKey | GUYBCBMZXIRUHH-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.15 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-1-ethylindole;6-bromo-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1-ethylindole;6-bromo-1H-indole?
The IUPAC name of 6-bromo-1-ethylindole;6-bromo-1H-indole (CID 158373742) is 6-bromo-1-ethylindole;6-bromo-1H-indole.
What is the SMILES notation for 6-bromo-1-ethylindole;6-bromo-1H-indole?
The canonical SMILES for 6-bromo-1-ethylindole;6-bromo-1H-indole is Brc1ccc2cc[nH]c2c1.CCn1ccc2ccc(Br)cc21.
What is the InChIKey of 6-bromo-1-ethylindole;6-bromo-1H-indole?
The InChIKey is GUYBCBMZXIRUHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrN.C8H6BrN/c1-2-12-6-5-8-3-4-9(11)7-10(8)12;9-7-2-1-6-3-4-10-8(6)5-7/h3-7H,2H2,1H3;1-5,10H.
What are the key properties of 6-bromo-1-ethylindole;6-bromo-1H-indole?
6-bromo-1-ethylindole;6-bromo-1H-indole has a molecular weight of 420.15 g/mol, XLogP of 6.35, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1-ethylindole;6-bromo-1H-indole is sourced from PubChem (CID 158373742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).