C47H68Cl2N4O5 — CID 158327411
2,8-bis[(4-methoxyphenyl)methyl]-3,3-dimethyl-2,8-diazaspiro[4.5]decane;1-chloroethyl carbonochloridate;2-[(4-methoxyphenyl)methyl]-3,3-dimethyl-2,8-diazaspiro[4.5]decane (PubChem CID 158327411) has the molecular formula C47H68Cl2N4O5 and a molecular weight of 839.99 g/mol. Its IUPAC name is 2,8-bis[(4-methoxyphenyl)methyl]-3,3-dimethyl-2,8-diazaspiro[4.5]decane;1-chloroethyl carbonochloridate;2-[(4-methoxyphenyl)methyl]-3,3-dimethyl-2,8-diazaspiro[4.5]decane.
| Compound Name | 2,8-bis[(4-methoxyphenyl)methyl]-3,3-dimethyl-2,8-diazaspiro[4.5]decane;1-chloroethyl carbonochloridate;2-[(4-methoxyphenyl)methyl]-3,3-dimethyl-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 158327411 |
| Molecular Formula | C47H68Cl2N4O5 |
| Molecular Weight | 839.99 g/mol |
| Exact Mass | 838.46 |
| IUPAC Name | 2,8-bis[(4-methoxyphenyl)methyl]-3,3-dimethyl-2,8-diazaspiro[4.5]decane;1-chloroethyl carbonochloridate;2-[(4-methoxyphenyl)methyl]-3,3-dimethyl-2,8-diazaspiro[4.5]decane |
| SMILES | CC(Cl)OC(=O)Cl.COc1ccc(CN2CC3(CCNCC3)CC2(C)C)cc1.COc1ccc(CN2CCC3(CC2)CN(Cc2ccc(OC)cc2)C(C)(C)C3)cc1 |
| InChI | InChI=1S/C26H36N2O2.C18H28N2O.C3H4Cl2O2/c1-25(2)19-26(20-28(25)18-22-7-11-24(30-4)12-8-22)13-15-27(16-14-26)17-21-5-9-23(29-3)10-6-21;1-17(2)13-18(8-10-19-11-9-18)14-20(17)12-15-4-6-16(21-3)7-5-15;1-2(4)7-3(5)6/h5-12H,13-20H2,1-4H3;4-7,19H,8-14H2,1-3H3;2H,1H3 |
| InChIKey | GPOSEYMZVRVXNF-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 75.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.99 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|