C46H27Cl3N4O8S4 — CID 158327609
5-methyl-2-[[2',7,7'-tris[(5-chloro-2-pyridinyl)sulfonyl]-9,9'-spirobi[fluorene]-2-yl]sulfonyl]pyridine (PubChem CID 158327609) has the molecular formula C46H27Cl3N4O8S4 and a molecular weight of 998.37 g/mol. Its IUPAC name is 5-methyl-2-[[2',7,7'-tris[(5-chloro-2-pyridinyl)sulfonyl]-9,9'-spirobi[fluorene]-2-yl]sulfonyl]pyridine.
| Compound Name | 5-methyl-2-[[2',7,7'-tris[(5-chloro-2-pyridinyl)sulfonyl]-9,9'-spirobi[fluorene]-2-yl]sulfonyl]pyridine |
|---|---|
| PubChem CID | 158327609 |
| Molecular Formula | C46H27Cl3N4O8S4 |
| Molecular Weight | 998.37 g/mol |
| Exact Mass | 995.98 |
| IUPAC Name | 5-methyl-2-[[2',7,7'-tris[(5-chloro-2-pyridinyl)sulfonyl]-9,9'-spirobi[fluorene]-2-yl]sulfonyl]pyridine |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc3c(c2)C2(c4cc(S(=O)(=O)c5ccc(Cl)cn5)ccc4-3)c3cc(S(=O)(=O)c4ccc(Cl)cn4)ccc3-c3ccc(S(=O)(=O)c4ccc(Cl)cn4)cc32)nc1 |
| InChI | InChI=1S/C46H27Cl3N4O8S4/c1-26-2-14-42(50-22-26)62(54,55)30-6-10-34-35-11-7-31(63(56,57)43-15-3-27(47)23-51-43)19-39(35)46(38(34)18-30)40-20-32(64(58,59)44-16-4-28(48)24-52-44)8-12-36(40)37-13-9-33(21-41(37)46)65(60,61)45-17-5-29(49)25-53-45/h2-25H,1H3 |
| InChIKey | IVUAGMAFRMYHAD-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 188.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 998.37 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |