C19H15ClN2O3S — CID 53002958
6-(4-chlorophenyl)sulfonyl-N-(4-methylphenyl)pyridine-3-carboxamide (PubChem CID 53002958) has the molecular formula C19H15ClN2O3S and a molecular weight of 386.86 g/mol. Its IUPAC name is 6-(4-chlorophenyl)sulfonyl-N-(4-methylphenyl)pyridine-3-carboxamide.
| Compound Name | 6-(4-chlorophenyl)sulfonyl-N-(4-methylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 53002958 |
| Molecular Formula | C19H15ClN2O3S |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | 6-(4-chlorophenyl)sulfonyl-N-(4-methylphenyl)pyridine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(S(=O)(=O)c3ccc(Cl)cc3)nc2)cc1 |
| InChI | InChI=1S/C19H15ClN2O3S/c1-13-2-7-16(8-3-13)22-19(23)14-4-11-18(21-12-14)26(24,25)17-9-5-15(20)6-10-17/h2-12H,1H3,(H,22,23) |
| InChIKey | VSETVILKFSMAIE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |