C23H17ClN2O5S — CID 54687803
3-(4-chlorophenyl)sulfonyl-4-hydroxy-N-(4-methylphenyl)-2-oxo-1H-quinoline-7-carboxamide (PubChem CID 54687803) has the molecular formula C23H17ClN2O5S and a molecular weight of 468.92 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfonyl-4-hydroxy-N-(4-methylphenyl)-2-oxo-1H-quinoline-7-carboxamide.
| Compound Name | 3-(4-chlorophenyl)sulfonyl-4-hydroxy-N-(4-methylphenyl)-2-oxo-1H-quinoline-7-carboxamide |
|---|---|
| PubChem CID | 54687803 |
| Molecular Formula | C23H17ClN2O5S |
| Molecular Weight | 468.92 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | 3-(4-chlorophenyl)sulfonyl-4-hydroxy-N-(4-methylphenyl)-2-oxo-1H-quinoline-7-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc3c(O)c(S(=O)(=O)c4ccc(Cl)cc4)c(=O)[nH]c3c2)cc1 |
| InChI | InChI=1S/C23H17ClN2O5S/c1-13-2-7-16(8-3-13)25-22(28)14-4-11-18-19(12-14)26-23(29)21(20(18)27)32(30,31)17-9-5-15(24)6-10-17/h2-12H,1H3,(H,25,28)(H2,26,27,29) |
| InChIKey | RYCWATNYUJATTL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.92 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |