About 5-fluoropyridine-3-carbaldehyde;1-(5-fluoro-3-pyridinyl)-N-methylmethanamine;methane
5-fluoropyridine-3-carbaldehyde;1-(5-fluoro-3-pyridinyl)-N-methylmethanamine;methane (PubChem CID 158330652) has the molecular formula C14H17F2N3O
and a molecular weight of 281.31 g/mol. Its IUPAC name is 5-fluoropyridine-3-carbaldehyde;1-(5-fluoro-3-pyridinyl)-N-methylmethanamine;methane.
Molecular Properties
| Compound Name | 5-fluoropyridine-3-carbaldehyde;1-(5-fluoro-3-pyridinyl)-N-methylmethanamine;methane |
| PubChem CID | 158330652 |
| Molecular Formula | C14H17F2N3O |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 5-fluoropyridine-3-carbaldehyde;1-(5-fluoro-3-pyridinyl)-N-methylmethanamine;methane |
| SMILES | C.CNCc1cncc(F)c1.O=Cc1cncc(F)c1 |
| InChI | InChI=1S/C7H9FN2.C6H4FNO.CH4/c1-9-3-6-2-7(8)5-10-4-6;7-6-1-5(4-9)2-8-3-6;/h2,4-5,9H,3H2,1H3;1-4H;1H4 |
| InChIKey | GPYSOHLKXLURPR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoropyridine-3-carbaldehyde;1-(5-fluoro-3-pyridinyl)-N-methylmethanamine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoropyridine-3-carbaldehyde;1-(5-fluoro-3-pyridinyl)-N-methylmethanamine;methane?
The IUPAC name of 5-fluoropyridine-3-carbaldehyde;1-(5-fluoro-3-pyridinyl)-N-methylmethanamine;methane (CID 158330652) is 5-fluoropyridine-3-carbaldehyde;1-(5-fluoro-3-pyridinyl)-N-methylmethanamine;methane.
What is the SMILES notation for 5-fluoropyridine-3-carbaldehyde;1-(5-fluoro-3-pyridinyl)-N-methylmethanamine;methane?
The canonical SMILES for 5-fluoropyridine-3-carbaldehyde;1-(5-fluoro-3-pyridinyl)-N-methylmethanamine;methane is C.CNCc1cncc(F)c1.O=Cc1cncc(F)c1.
What is the InChIKey of 5-fluoropyridine-3-carbaldehyde;1-(5-fluoro-3-pyridinyl)-N-methylmethanamine;methane?
The InChIKey is GPYSOHLKXLURPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9FN2.C6H4FNO.CH4/c1-9-3-6-2-7(8)5-10-4-6;7-6-1-5(4-9)2-8-3-6;/h2,4-5,9H,3H2,1H3;1-4H;1H4.
What are the key properties of 5-fluoropyridine-3-carbaldehyde;1-(5-fluoro-3-pyridinyl)-N-methylmethanamine;methane?
5-fluoropyridine-3-carbaldehyde;1-(5-fluoro-3-pyridinyl)-N-methylmethanamine;methane has a molecular weight of 281.31 g/mol, XLogP of 2.61, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoropyridine-3-carbaldehyde;1-(5-fluoro-3-pyridinyl)-N-methylmethanamine;methane is sourced from PubChem (CID 158330652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).