C42H26F3N5 — CID 158331126
9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-isocyanophenyl]-3-[3-methyl-5-(trifluoromethyl)phenyl]carbazole (PubChem CID 158331126) has the molecular formula C42H26F3N5 and a molecular weight of 657.70 g/mol. Its IUPAC name is 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-isocyanophenyl]-3-[3-methyl-5-(trifluoromethyl)phenyl]carbazole.
| Compound Name | 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-isocyanophenyl]-3-[3-methyl-5-(trifluoromethyl)phenyl]carbazole |
|---|---|
| PubChem CID | 158331126 |
| Molecular Formula | C42H26F3N5 |
| Molecular Weight | 657.70 g/mol |
| Exact Mass | 657.21 |
| IUPAC Name | 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-isocyanophenyl]-3-[3-methyl-5-(trifluoromethyl)phenyl]carbazole |
| SMILES | [C-]#[N+]c1cc(-n2c3ccccc3c3cc(-c4cc(C)cc(C(F)(F)F)c4)ccc32)ccc1-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C42H26F3N5/c1-26-21-30(23-31(22-26)42(43,44)45)29-17-20-38-35(24-29)33-15-9-10-16-37(33)50(38)32-18-19-34(36(25-32)46-2)41-48-39(27-11-5-3-6-12-27)47-40(49-41)28-13-7-4-8-14-28/h3-25H,1H3 |
| InChIKey | JHZBPGFYLCGKNQ-UHFFFAOYSA-N |
| XLogP | 11.51 |
| TPSA | 47.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.70 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|