C53H32F6N4 — CID 162611705
9-[3-[3,5-bis(trifluoromethyl)phenyl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-diphenylcarbazole (PubChem CID 162611705) has the molecular formula C53H32F6N4 and a molecular weight of 838.86 g/mol. Its IUPAC name is 9-[3-[3,5-bis(trifluoromethyl)phenyl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-diphenylcarbazole.
| Compound Name | 9-[3-[3,5-bis(trifluoromethyl)phenyl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-diphenylcarbazole |
|---|---|
| PubChem CID | 162611705 |
| Molecular Formula | C53H32F6N4 |
| Molecular Weight | 838.86 g/mol |
| Exact Mass | 838.25 |
| IUPAC Name | 9-[3-[3,5-bis(trifluoromethyl)phenyl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-diphenylcarbazole |
| SMILES | FC(F)(F)c1cc(-c2cc(-n3c4ccc(-c5ccccc5)cc4c4cc(-c5ccccc5)ccc43)ccc2-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C53H32F6N4/c54-52(55,56)40-27-39(28-41(31-40)53(57,58)59)44-32-42(23-24-43(44)51-61-49(35-17-9-3-10-18-35)60-50(62-51)36-19-11-4-12-20-36)63-47-25-21-37(33-13-5-1-6-14-33)29-45(47)46-30-38(22-26-48(46)63)34-15-7-2-8-16-34/h1-32H |
| InChIKey | ASRIPNYLVQSYTH-UHFFFAOYSA-N |
| XLogP | 15.01 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.86 |
| LogP ≤ 5 | 15.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |