C57H28F6N8 — CID 166669960
4-[9-[3-[3,5-bis(trifluoromethyl)phenyl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-(2,4-dicyanophenyl)carbazol-3-yl]benzene-1,3-dicarbonitrile (PubChem CID 166669960) has the molecular formula C57H28F6N8 and a molecular weight of 938.89 g/mol. Its IUPAC name is 4-[9-[3-[3,5-bis(trifluoromethyl)phenyl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-(2,4-dicyanophenyl)carbazol-3-yl]benzene-1,3-dicarbonitrile.
| Compound Name | 4-[9-[3-[3,5-bis(trifluoromethyl)phenyl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-(2,4-dicyanophenyl)carbazol-3-yl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 166669960 |
| Molecular Formula | C57H28F6N8 |
| Molecular Weight | 938.89 g/mol |
| Exact Mass | 938.23 |
| IUPAC Name | 4-[9-[3-[3,5-bis(trifluoromethyl)phenyl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-(2,4-dicyanophenyl)carbazol-3-yl]benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1ccc(-c2ccc3c(c2)c2cc(-c4ccc(C#N)cc4C#N)ccc2n3-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c2)c(C#N)c1 |
| InChI | InChI=1S/C57H28F6N8/c58-56(59,60)42-23-39(24-43(27-42)57(61,62)63)48-28-44(15-18-47(48)55-69-53(35-7-3-1-4-8-35)68-54(70-55)36-9-5-2-6-10-36)71-51-19-13-37(45-16-11-33(29-64)21-40(45)31-66)25-49(51)50-26-38(14-20-52(50)71)46-17-12-34(30-65)22-41(46)32-67/h1-28H |
| InChIKey | SYGSVLQUFPJXDO-UHFFFAOYSA-N |
| XLogP | 14.50 |
| TPSA | 138.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 938.89 |
| LogP ≤ 5 | 14.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |