C59H44F6N4 — CID 162611765
9-[3-[3,5-bis(trifluoromethyl)phenyl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,7-bis(2,4,6-trimethylphenyl)carbazole (PubChem CID 162611765) has the molecular formula C59H44F6N4 and a molecular weight of 923.02 g/mol. Its IUPAC name is 9-[3-[3,5-bis(trifluoromethyl)phenyl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,7-bis(2,4,6-trimethylphenyl)carbazole.
| Compound Name | 9-[3-[3,5-bis(trifluoromethyl)phenyl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,7-bis(2,4,6-trimethylphenyl)carbazole |
|---|---|
| PubChem CID | 162611765 |
| Molecular Formula | C59H44F6N4 |
| Molecular Weight | 923.02 g/mol |
| Exact Mass | 922.35 |
| IUPAC Name | 9-[3-[3,5-bis(trifluoromethyl)phenyl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,7-bis(2,4,6-trimethylphenyl)carbazole |
| SMILES | Cc1cc(C)c(-c2ccc3c4ccc(-c5c(C)cc(C)cc5C)cc4n(-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c(-c5cc(C(F)(F)F)cc(C(F)(F)F)c5)c4)c3c2)c(C)c1 |
| InChI | InChI=1S/C59H44F6N4/c1-33-23-35(3)53(36(4)24-33)41-17-20-47-48-21-18-42(54-37(5)25-34(2)26-38(54)6)30-52(48)69(51(47)29-41)46-19-22-49(50(32-46)43-27-44(58(60,61)62)31-45(28-43)59(63,64)65)57-67-55(39-13-9-7-10-14-39)66-56(68-57)40-15-11-8-12-16-40/h7-32H,1-6H3 |
| InChIKey | ALOQKICHEMGDDS-UHFFFAOYSA-N |
| XLogP | 16.86 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.02 |
| LogP ≤ 5 | 16.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |