C50H34F6N4 — CID 162611758
9-[5-[2,4-bis(trifluoromethyl)phenyl]-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-(2,4,6-trimethylphenyl)carbazole (PubChem CID 162611758) has the molecular formula C50H34F6N4 and a molecular weight of 804.84 g/mol. Its IUPAC name is 9-[5-[2,4-bis(trifluoromethyl)phenyl]-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-(2,4,6-trimethylphenyl)carbazole.
| Compound Name | 9-[5-[2,4-bis(trifluoromethyl)phenyl]-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-(2,4,6-trimethylphenyl)carbazole |
|---|---|
| PubChem CID | 162611758 |
| Molecular Formula | C50H34F6N4 |
| Molecular Weight | 804.84 g/mol |
| Exact Mass | 804.27 |
| IUPAC Name | 9-[5-[2,4-bis(trifluoromethyl)phenyl]-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-(2,4,6-trimethylphenyl)carbazole |
| SMILES | Cc1cc(C)c(-c2ccc3c4ccccc4n(-c4cc(-c5ccc(C(F)(F)F)cc5C(F)(F)F)ccc4-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3c2)c(C)c1 |
| InChI | InChI=1S/C50H34F6N4/c1-29-24-30(2)45(31(3)25-29)35-19-21-39-38-16-10-11-17-42(38)60(43(39)27-35)44-26-34(37-23-20-36(49(51,52)53)28-41(37)50(54,55)56)18-22-40(44)48-58-46(32-12-6-4-7-13-32)57-47(59-48)33-14-8-5-9-15-33/h4-28H,1-3H3 |
| InChIKey | WJYIANFQHFOHDH-UHFFFAOYSA-N |
| XLogP | 14.27 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.84 |
| LogP ≤ 5 | 14.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |