C45H30F3N7 — CID 138486662
2-(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[2-(trifluoromethyl)phenyl]phenyl]carbazole (PubChem CID 138486662) has the molecular formula C45H30F3N7 and a molecular weight of 725.78 g/mol. Its IUPAC name is 2-(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[2-(trifluoromethyl)phenyl]phenyl]carbazole.
| Compound Name | 2-(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[2-(trifluoromethyl)phenyl]phenyl]carbazole |
|---|---|
| PubChem CID | 138486662 |
| Molecular Formula | C45H30F3N7 |
| Molecular Weight | 725.78 g/mol |
| Exact Mass | 725.25 |
| IUPAC Name | 2-(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[2-(trifluoromethyl)phenyl]phenyl]carbazole |
| SMILES | Cc1nc(C)nc(-c2ccc3c4ccccc4n(-c4cc(-c5ccccc5C(F)(F)F)ccc4-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3c2)n1 |
| InChI | InChI=1S/C45H30F3N7/c1-27-49-28(2)51-43(50-27)32-22-23-35-34-18-10-12-20-38(34)55(39(35)26-32)40-25-31(33-17-9-11-19-37(33)45(46,47)48)21-24-36(40)44-53-41(29-13-5-3-6-14-29)52-42(54-44)30-15-7-4-8-16-30/h3-26H,1-2H3 |
| InChIKey | YYDPONTYASWPOU-UHFFFAOYSA-N |
| XLogP | 11.12 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.78 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |