C46H34F3N11 — CID 134321401
2-(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[5-(4,6-dimethyl-1,3,5-triazin-2-yl)-3-[2-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-(trifluoromethyl)phenyl]carbazole (PubChem CID 134321401) has the molecular formula C46H34F3N11 and a molecular weight of 797.85 g/mol. Its IUPAC name is 2-(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[5-(4,6-dimethyl-1,3,5-triazin-2-yl)-3-[2-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-(trifluoromethyl)phenyl]carbazole.
| Compound Name | 2-(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[5-(4,6-dimethyl-1,3,5-triazin-2-yl)-3-[2-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-(trifluoromethyl)phenyl]carbazole |
|---|---|
| PubChem CID | 134321401 |
| Molecular Formula | C46H34F3N11 |
| Molecular Weight | 797.85 g/mol |
| Exact Mass | 797.30 |
| IUPAC Name | 2-(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[5-(4,6-dimethyl-1,3,5-triazin-2-yl)-3-[2-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-(trifluoromethyl)phenyl]carbazole |
| SMILES | Cc1nc(C)nc(-c2cc(-n3c4ccccc4c4ccc(-c5nc(C)nc(C)n5)cc43)c(C(F)(F)F)c(-n3c4ccccc4c4ccc(-c5nc(C)nc(C)n5)cc43)c2)n1 |
| InChI | InChI=1S/C46H34F3N11/c1-23-50-24(2)54-43(53-23)29-15-17-34-32-11-7-9-13-36(32)59(38(34)19-29)40-21-31(45-57-27(5)52-28(6)58-45)22-41(42(40)46(47,48)49)60-37-14-10-8-12-33(37)35-18-16-30(20-39(35)60)44-55-25(3)51-26(4)56-44/h7-22H,1-6H3 |
| InChIKey | MTOWLGRZHLLIGD-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 125.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.85 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |