C52H36F3N9 — CID 155216705
2-(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[3-[2-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-(6-phenyl-2-pyridinyl)-5-(trifluoromethyl)phenyl]carbazole (PubChem CID 155216705) has the molecular formula C52H36F3N9 and a molecular weight of 843.92 g/mol. Its IUPAC name is 2-(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[3-[2-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-(6-phenyl-2-pyridinyl)-5-(trifluoromethyl)phenyl]carbazole.
| Compound Name | 2-(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[3-[2-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-(6-phenyl-2-pyridinyl)-5-(trifluoromethyl)phenyl]carbazole |
|---|---|
| PubChem CID | 155216705 |
| Molecular Formula | C52H36F3N9 |
| Molecular Weight | 843.92 g/mol |
| Exact Mass | 843.30 |
| IUPAC Name | 2-(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[3-[2-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-(6-phenyl-2-pyridinyl)-5-(trifluoromethyl)phenyl]carbazole |
| SMILES | Cc1nc(C)nc(-c2ccc3c4ccccc4n(-c4cc(C(F)(F)F)cc(-n5c6ccccc6c6ccc(-c7nc(C)nc(C)n7)cc65)c4-c4cccc(-c5ccccc5)n4)c3c2)n1 |
| InChI | InChI=1S/C52H36F3N9/c1-29-56-30(2)59-50(58-29)34-21-23-39-37-15-8-10-19-43(37)63(45(39)25-34)47-27-36(52(53,54)55)28-48(49(47)42-18-12-17-41(62-42)33-13-6-5-7-14-33)64-44-20-11-9-16-38(44)40-24-22-35(26-46(40)64)51-60-31(3)57-32(4)61-51/h5-28H,1-4H3 |
| InChIKey | QZCCMKJPRDLACH-UHFFFAOYSA-N |
| XLogP | 12.57 |
| TPSA | 100.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.92 |
| LogP ≤ 5 | 12.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |