C58H45F3N4 — CID 138486817
9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-[4-(trifluoromethyl)phenyl]phenyl]-3,6-bis(2,4,6-trimethylphenyl)carbazole (PubChem CID 138486817) has the molecular formula C58H45F3N4 and a molecular weight of 855.02 g/mol. Its IUPAC name is 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-[4-(trifluoromethyl)phenyl]phenyl]-3,6-bis(2,4,6-trimethylphenyl)carbazole.
| Compound Name | 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-[4-(trifluoromethyl)phenyl]phenyl]-3,6-bis(2,4,6-trimethylphenyl)carbazole |
|---|---|
| PubChem CID | 138486817 |
| Molecular Formula | C58H45F3N4 |
| Molecular Weight | 855.02 g/mol |
| Exact Mass | 854.36 |
| IUPAC Name | 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-[4-(trifluoromethyl)phenyl]phenyl]-3,6-bis(2,4,6-trimethylphenyl)carbazole |
| SMILES | Cc1cc(C)c(-c2ccc3c(c2)c2cc(-c4c(C)cc(C)cc4C)ccc2n3-c2ccc(-c3ccc(C(F)(F)F)cc3)c(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)c(C)c1 |
| InChI | InChI=1S/C58H45F3N4/c1-34-27-36(3)53(37(4)28-34)43-19-25-51-48(31-43)49-32-44(54-38(5)29-35(2)30-39(54)6)20-26-52(49)65(51)46-23-24-47(40-17-21-45(22-18-40)58(59,60)61)50(33-46)57-63-55(41-13-9-7-10-14-41)62-56(64-57)42-15-11-8-12-16-42/h7-33H,1-6H3 |
| InChIKey | WPCTTYPCEAMKIU-UHFFFAOYSA-N |
| XLogP | 15.84 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.02 |
| LogP ≤ 5 | 15.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |