C24H26BCl3N8O2 — CID 158332741
4-chloro-6-(2-methylpyrimidin-5-yl)pyrimidine;4,6-dichloropyrimidine;2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine (PubChem CID 158332741) has the molecular formula C24H26BCl3N8O2 and a molecular weight of 575.70 g/mol. Its IUPAC name is 4-chloro-6-(2-methylpyrimidin-5-yl)pyrimidine;4,6-dichloropyrimidine;2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine.
| Compound Name | 4-chloro-6-(2-methylpyrimidin-5-yl)pyrimidine;4,6-dichloropyrimidine;2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
|---|---|
| PubChem CID | 158332741 |
| Molecular Formula | C24H26BCl3N8O2 |
| Molecular Weight | 575.70 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | 4-chloro-6-(2-methylpyrimidin-5-yl)pyrimidine;4,6-dichloropyrimidine;2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
| SMILES | Cc1ncc(-c2cc(Cl)ncn2)cn1.Cc1ncc(B2OC(C)(C)C(C)(C)O2)cn1.Clc1cc(Cl)ncn1 |
| InChI | InChI=1S/C11H17BN2O2.C9H7ClN4.C4H2Cl2N2/c1-8-13-6-9(7-14-8)12-15-10(2,3)11(4,5)16-12;1-6-11-3-7(4-12-6)8-2-9(10)14-5-13-8;5-3-1-4(6)8-2-7-3/h6-7H,1-5H3;2-5H,1H3;1-2H |
| InChIKey | GQEZTAMXJKMKCO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 121.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.70 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|