C33H43NO9 — CID 158335353
benzyl (4R)-4-[[(4R)-8-(2-methoxyethoxy)-1,5-dioxo-1-phenylmethoxyoctan-4-yl]carbamoyl]-6-oxoheptanoate (PubChem CID 158335353) has the molecular formula C33H43NO9 and a molecular weight of 597.71 g/mol. Its IUPAC name is benzyl (4R)-4-[[(4R)-8-(2-methoxyethoxy)-1,5-dioxo-1-phenylmethoxyoctan-4-yl]carbamoyl]-6-oxoheptanoate.
| Compound Name | benzyl (4R)-4-[[(4R)-8-(2-methoxyethoxy)-1,5-dioxo-1-phenylmethoxyoctan-4-yl]carbamoyl]-6-oxoheptanoate |
|---|---|
| PubChem CID | 158335353 |
| Molecular Formula | C33H43NO9 |
| Molecular Weight | 597.71 g/mol |
| Exact Mass | 597.29 |
| IUPAC Name | benzyl (4R)-4-[[(4R)-8-(2-methoxyethoxy)-1,5-dioxo-1-phenylmethoxyoctan-4-yl]carbamoyl]-6-oxoheptanoate |
| SMILES | COCCOCCCC(=O)[C@@H](CCC(=O)OCc1ccccc1)NC(=O)[C@H](CCC(=O)OCc1ccccc1)CC(C)=O |
| InChI | InChI=1S/C33H43NO9/c1-25(35)22-28(15-17-31(37)42-23-26-10-5-3-6-11-26)33(39)34-29(30(36)14-9-19-41-21-20-40-2)16-18-32(38)43-24-27-12-7-4-8-13-27/h3-8,10-13,28-29H,9,14-24H2,1-2H3,(H,34,39)/t28-,29-/m1/s1 |
| InChIKey | YYNALWWFQDECEA-FQLXRVMXSA-N |
| XLogP | 4.13 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.71 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|