C10H20O2Si — CID 158336183
[(2S,3R,4S)-2,4-dimethyl-3,4-dihydro-2H-pyran-3-yl]oxy-trimethylsilane (PubChem CID 158336183) has the molecular formula C10H20O2Si and a molecular weight of 200.35 g/mol. Its IUPAC name is [(2S,3R,4S)-2,4-dimethyl-3,4-dihydro-2H-pyran-3-yl]oxy-trimethylsilane.
| Compound Name | [(2S,3R,4S)-2,4-dimethyl-3,4-dihydro-2H-pyran-3-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 158336183 |
| Molecular Formula | C10H20O2Si |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | [(2S,3R,4S)-2,4-dimethyl-3,4-dihydro-2H-pyran-3-yl]oxy-trimethylsilane |
| SMILES | C[C@@H]1OC=C[C@H](C)[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C10H20O2Si/c1-8-6-7-11-9(2)10(8)12-13(3,4)5/h6-10H,1-5H3/t8-,9-,10+/m0/s1 |
| InChIKey | XDCBQOYQYRTWMU-LPEHRKFASA-N |
| XLogP | 2.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|