C9H21N2O6P — CID 158341162
3-[(2-methylpropan-2-yl)oxymethyl]piperazin-2-one;phosphoric acid (PubChem CID 158341162) has the molecular formula C9H21N2O6P and a molecular weight of 284.25 g/mol. Its IUPAC name is 3-[(2-methylpropan-2-yl)oxymethyl]piperazin-2-one;phosphoric acid.
| Compound Name | 3-[(2-methylpropan-2-yl)oxymethyl]piperazin-2-one;phosphoric acid |
|---|---|
| PubChem CID | 158341162 |
| Molecular Formula | C9H21N2O6P |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 3-[(2-methylpropan-2-yl)oxymethyl]piperazin-2-one;phosphoric acid |
| SMILES | CC(C)(C)OCC1NCCNC1=O.O=P(O)(O)O |
| InChI | InChI=1S/C9H18N2O2.H3O4P/c1-9(2,3)13-6-7-8(12)11-5-4-10-7;1-5(2,3)4/h7,10H,4-6H2,1-3H3,(H,11,12);(H3,1,2,3,4) |
| InChIKey | GREGMWMIKCBCHE-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 128.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|