C11H10O2S — CID 15834119
5-thiatricyclo[6.2.2.02,6]dodeca-2(6),3-diene-7,9-dione (PubChem CID 15834119) has the molecular formula C11H10O2S and a molecular weight of 206.27 g/mol. Its IUPAC name is 5-thiatricyclo[6.2.2.02,6]dodeca-2(6),3-diene-7,9-dione.
| Compound Name | 5-thiatricyclo[6.2.2.02,6]dodeca-2(6),3-diene-7,9-dione |
|---|---|
| PubChem CID | 15834119 |
| Molecular Formula | C11H10O2S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 5-thiatricyclo[6.2.2.02,6]dodeca-2(6),3-diene-7,9-dione |
| SMILES | O=C1CC2CCC1C(=O)c1sccc12 |
| InChI | InChI=1S/C11H10O2S/c12-9-5-6-1-2-8(9)10(13)11-7(6)3-4-14-11/h3-4,6,8H,1-2,5H2 |
| InChIKey | MJCIPTGUKKXEPY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|