C28H29N3O — CID 158341711
(E)-10-(2-phenylpyrrolo[2,3-b]pyridin-1-yl)-1-pyridin-3-yldec-1-en-3-one (PubChem CID 158341711) has the molecular formula C28H29N3O and a molecular weight of 423.56 g/mol. Its IUPAC name is (E)-10-(2-phenylpyrrolo[2,3-b]pyridin-1-yl)-1-pyridin-3-yldec-1-en-3-one.
| Compound Name | (E)-10-(2-phenylpyrrolo[2,3-b]pyridin-1-yl)-1-pyridin-3-yldec-1-en-3-one |
|---|---|
| PubChem CID | 158341711 |
| Molecular Formula | C28H29N3O |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | (E)-10-(2-phenylpyrrolo[2,3-b]pyridin-1-yl)-1-pyridin-3-yldec-1-en-3-one |
| SMILES | O=C(/C=C/c1cccnc1)CCCCCCCn1c(-c2ccccc2)cc2cccnc21 |
| InChI | InChI=1S/C28H29N3O/c32-26(17-16-23-11-9-18-29-22-23)15-7-2-1-3-8-20-31-27(24-12-5-4-6-13-24)21-25-14-10-19-30-28(25)31/h4-6,9-14,16-19,21-22H,1-3,7-8,15,20H2/b17-16+ |
| InChIKey | JVLVCAFCJNBMDC-WUKNDPDISA-N |
| XLogP | 6.72 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|