carbon dioxide;2-methyl-5-thiophen-3-ylfuran

C10H8O3S — CID 158341823

IUPACcarbon dioxide;2-methyl-5-thiophen-3-ylfuran
SMILESCc1ccc(-c2ccsc2)o1.O=C=O
InChIInChI=1S/C9H8OS.CO2/c1-7-2-3-9(10-7)8-4-5-11-6-8;2-1-3/h2-6H,1H3;
InChIKeyGRGIHRJBTKUXIO-UHFFFAOYSA-N
MW208.24 g/mol
LogP2.73
Rot. Bonds1

About carbon dioxide;2-methyl-5-thiophen-3-ylfuran

carbon dioxide;2-methyl-5-thiophen-3-ylfuran (PubChem CID 158341823) has the molecular formula C10H8O3S and a molecular weight of 208.24 g/mol. Its IUPAC name is carbon dioxide;2-methyl-5-thiophen-3-ylfuran.

Molecular Properties

Compound Namecarbon dioxide;2-methyl-5-thiophen-3-ylfuran
PubChem CID158341823
Molecular FormulaC10H8O3S
Molecular Weight208.24 g/mol
Exact Mass208.02
IUPAC Namecarbon dioxide;2-methyl-5-thiophen-3-ylfuran
SMILESCc1ccc(-c2ccsc2)o1.O=C=O
InChIInChI=1S/C9H8OS.CO2/c1-7-2-3-9(10-7)8-4-5-11-6-8;2-1-3/h2-6H,1H3;
InChIKeyGRGIHRJBTKUXIO-UHFFFAOYSA-N
XLogP2.73
TPSA47.28 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.24
LogP ≤ 52.73
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze carbon dioxide;2-methyl-5-thiophen-3-ylfuran with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon dioxide;2-methyl-5-thiophen-3-ylfuran?
The IUPAC name of carbon dioxide;2-methyl-5-thiophen-3-ylfuran (CID 158341823) is carbon dioxide;2-methyl-5-thiophen-3-ylfuran.
What is the SMILES notation for carbon dioxide;2-methyl-5-thiophen-3-ylfuran?
The canonical SMILES for carbon dioxide;2-methyl-5-thiophen-3-ylfuran is Cc1ccc(-c2ccsc2)o1.O=C=O.
What is the InChIKey of carbon dioxide;2-methyl-5-thiophen-3-ylfuran?
The InChIKey is GRGIHRJBTKUXIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8OS.CO2/c1-7-2-3-9(10-7)8-4-5-11-6-8;2-1-3/h2-6H,1H3;.
What are the key properties of carbon dioxide;2-methyl-5-thiophen-3-ylfuran?
carbon dioxide;2-methyl-5-thiophen-3-ylfuran has a molecular weight of 208.24 g/mol, XLogP of 2.73, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;2-methyl-5-thiophen-3-ylfuran is sourced from PubChem (CID 158341823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).