C27H32N2O3Si — CID 158342092
N-[1-(4-methoxyphenyl)-2-oxo-3-(4-trimethylsilylphenyl)propyl]-N-methyl-2-pyridin-3-ylacetamide (PubChem CID 158342092) has the molecular formula C27H32N2O3Si and a molecular weight of 460.65 g/mol. Its IUPAC name is N-[1-(4-methoxyphenyl)-2-oxo-3-(4-trimethylsilylphenyl)propyl]-N-methyl-2-pyridin-3-ylacetamide.
| Compound Name | N-[1-(4-methoxyphenyl)-2-oxo-3-(4-trimethylsilylphenyl)propyl]-N-methyl-2-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 158342092 |
| Molecular Formula | C27H32N2O3Si |
| Molecular Weight | 460.65 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | N-[1-(4-methoxyphenyl)-2-oxo-3-(4-trimethylsilylphenyl)propyl]-N-methyl-2-pyridin-3-ylacetamide |
| SMILES | COc1ccc(C(C(=O)Cc2ccc([Si](C)(C)C)cc2)N(C)C(=O)Cc2cccnc2)cc1 |
| InChI | InChI=1S/C27H32N2O3Si/c1-29(26(31)18-21-7-6-16-28-19-21)27(22-10-12-23(32-2)13-11-22)25(30)17-20-8-14-24(15-9-20)33(3,4)5/h6-16,19,27H,17-18H2,1-5H3 |
| InChIKey | GRHBFRNNWIFPEW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.65 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|