C26H31N3O3Si — CID 140781161
2-(4-methoxyphenyl)-2-[methyl-(2-pyridin-3-ylacetyl)amino]-N-(4-trimethylsilylphenyl)acetamide (PubChem CID 140781161) has the molecular formula C26H31N3O3Si and a molecular weight of 461.64 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-2-[methyl-(2-pyridin-3-ylacetyl)amino]-N-(4-trimethylsilylphenyl)acetamide.
| Compound Name | 2-(4-methoxyphenyl)-2-[methyl-(2-pyridin-3-ylacetyl)amino]-N-(4-trimethylsilylphenyl)acetamide |
|---|---|
| PubChem CID | 140781161 |
| Molecular Formula | C26H31N3O3Si |
| Molecular Weight | 461.64 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 2-(4-methoxyphenyl)-2-[methyl-(2-pyridin-3-ylacetyl)amino]-N-(4-trimethylsilylphenyl)acetamide |
| SMILES | COc1ccc(C(C(=O)Nc2ccc([Si](C)(C)C)cc2)N(C)C(=O)Cc2cccnc2)cc1 |
| InChI | InChI=1S/C26H31N3O3Si/c1-29(24(30)17-19-7-6-16-27-18-19)25(20-8-12-22(32-2)13-9-20)26(31)28-21-10-14-23(15-11-21)33(3,4)5/h6-16,18,25H,17H2,1-5H3,(H,28,31) |
| InChIKey | LWRVMFACZFNERI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.64 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|