C28H33N3O4Si — CID 174064329
3-amino-N-[1-(4-methoxyphenyl)-2-oxo-2-(4-trimethylsilylanilino)ethyl]-N-methyl-4-(2-oxoethyl)benzamide (PubChem CID 174064329) has the molecular formula C28H33N3O4Si and a molecular weight of 503.68 g/mol. Its IUPAC name is 3-amino-N-[1-(4-methoxyphenyl)-2-oxo-2-(4-trimethylsilylanilino)ethyl]-N-methyl-4-(2-oxoethyl)benzamide.
| Compound Name | 3-amino-N-[1-(4-methoxyphenyl)-2-oxo-2-(4-trimethylsilylanilino)ethyl]-N-methyl-4-(2-oxoethyl)benzamide |
|---|---|
| PubChem CID | 174064329 |
| Molecular Formula | C28H33N3O4Si |
| Molecular Weight | 503.68 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 3-amino-N-[1-(4-methoxyphenyl)-2-oxo-2-(4-trimethylsilylanilino)ethyl]-N-methyl-4-(2-oxoethyl)benzamide |
| SMILES | COc1ccc(C(C(=O)Nc2ccc([Si](C)(C)C)cc2)N(C)C(=O)c2ccc(CC=O)c(N)c2)cc1 |
| InChI | InChI=1S/C28H33N3O4Si/c1-31(28(34)21-7-6-19(16-17-32)25(29)18-21)26(20-8-12-23(35-2)13-9-20)27(33)30-22-10-14-24(15-11-22)36(3,4)5/h6-15,17-18,26H,16,29H2,1-5H3,(H,30,33) |
| InChIKey | FPHHJVKOYUXLNH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.68 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|