C27H35N3O6Si — CID 140781375
N-[1-[4-(3-methoxypropoxymethyl)phenyl]-2-oxo-2-(4-trimethylsilylanilino)ethyl]-N-methyl-3-oxo-1,2-oxazole-5-carboxamide (PubChem CID 140781375) has the molecular formula C27H35N3O6Si and a molecular weight of 525.68 g/mol. Its IUPAC name is N-[1-[4-(3-methoxypropoxymethyl)phenyl]-2-oxo-2-(4-trimethylsilylanilino)ethyl]-N-methyl-3-oxo-1,2-oxazole-5-carboxamide.
| Compound Name | N-[1-[4-(3-methoxypropoxymethyl)phenyl]-2-oxo-2-(4-trimethylsilylanilino)ethyl]-N-methyl-3-oxo-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 140781375 |
| Molecular Formula | C27H35N3O6Si |
| Molecular Weight | 525.68 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | N-[1-[4-(3-methoxypropoxymethyl)phenyl]-2-oxo-2-(4-trimethylsilylanilino)ethyl]-N-methyl-3-oxo-1,2-oxazole-5-carboxamide |
| SMILES | COCCCOCc1ccc(C(C(=O)Nc2ccc([Si](C)(C)C)cc2)N(C)C(=O)c2cc(=O)[nH]o2)cc1 |
| InChI | InChI=1S/C27H35N3O6Si/c1-30(27(33)23-17-24(31)29-36-23)25(20-9-7-19(8-10-20)18-35-16-6-15-34-2)26(32)28-21-11-13-22(14-12-21)37(3,4)5/h7-14,17,25H,6,15-16,18H2,1-5H3,(H,28,32)(H,29,31) |
| InChIKey | KNEGRLZFONKTGA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.68 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|