C22H25N3O5Si — CID 140781371
N-[1-(4-methoxyphenyl)-2-oxo-2-(4-trimethylsilylanilino)ethyl]-3-oxo-1,2-oxazole-5-carboxamide (PubChem CID 140781371) has the molecular formula C22H25N3O5Si and a molecular weight of 439.54 g/mol. Its IUPAC name is N-[1-(4-methoxyphenyl)-2-oxo-2-(4-trimethylsilylanilino)ethyl]-3-oxo-1,2-oxazole-5-carboxamide.
| Compound Name | N-[1-(4-methoxyphenyl)-2-oxo-2-(4-trimethylsilylanilino)ethyl]-3-oxo-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 140781371 |
| Molecular Formula | C22H25N3O5Si |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | N-[1-(4-methoxyphenyl)-2-oxo-2-(4-trimethylsilylanilino)ethyl]-3-oxo-1,2-oxazole-5-carboxamide |
| SMILES | COc1ccc(C(NC(=O)c2cc(=O)[nH]o2)C(=O)Nc2ccc([Si](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H25N3O5Si/c1-29-16-9-5-14(6-10-16)20(24-21(27)18-13-19(26)25-30-18)22(28)23-15-7-11-17(12-8-15)31(2,3)4/h5-13,20H,1-4H3,(H,23,28)(H,24,27)(H,25,26) |
| InChIKey | FQIZZYVUDXQVLZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 113.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|