C23H28N4O5Si — CID 140781338
2-[[2-(2,5-dioxoimidazolidin-4-yl)acetyl]amino]-2-(4-methoxyphenyl)-N-(4-trimethylsilylphenyl)acetamide (PubChem CID 140781338) has the molecular formula C23H28N4O5Si and a molecular weight of 468.59 g/mol. Its IUPAC name is 2-[[2-(2,5-dioxoimidazolidin-4-yl)acetyl]amino]-2-(4-methoxyphenyl)-N-(4-trimethylsilylphenyl)acetamide.
| Compound Name | 2-[[2-(2,5-dioxoimidazolidin-4-yl)acetyl]amino]-2-(4-methoxyphenyl)-N-(4-trimethylsilylphenyl)acetamide |
|---|---|
| PubChem CID | 140781338 |
| Molecular Formula | C23H28N4O5Si |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 2-[[2-(2,5-dioxoimidazolidin-4-yl)acetyl]amino]-2-(4-methoxyphenyl)-N-(4-trimethylsilylphenyl)acetamide |
| SMILES | COc1ccc(C(NC(=O)CC2NC(=O)NC2=O)C(=O)Nc2ccc([Si](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C23H28N4O5Si/c1-32-16-9-5-14(6-10-16)20(26-19(28)13-18-21(29)27-23(31)25-18)22(30)24-15-7-11-17(12-8-15)33(2,3)4/h5-12,18,20H,13H2,1-4H3,(H,24,30)(H,26,28)(H2,25,27,29,31) |
| InChIKey | VBONUPYIRFRRBK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|