C26H35N3O4Si — CID 140781135
N-[1-(4-methoxyphenyl)-2-oxo-2-(4-trimethylsilylanilino)ethyl]-2-oxa-8-azaspiro[3.5]nonane-8-carboxamide (PubChem CID 140781135) has the molecular formula C26H35N3O4Si and a molecular weight of 481.67 g/mol. Its IUPAC name is N-[1-(4-methoxyphenyl)-2-oxo-2-(4-trimethylsilylanilino)ethyl]-2-oxa-8-azaspiro[3.5]nonane-8-carboxamide.
| Compound Name | N-[1-(4-methoxyphenyl)-2-oxo-2-(4-trimethylsilylanilino)ethyl]-2-oxa-8-azaspiro[3.5]nonane-8-carboxamide |
|---|---|
| PubChem CID | 140781135 |
| Molecular Formula | C26H35N3O4Si |
| Molecular Weight | 481.67 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | N-[1-(4-methoxyphenyl)-2-oxo-2-(4-trimethylsilylanilino)ethyl]-2-oxa-8-azaspiro[3.5]nonane-8-carboxamide |
| SMILES | COc1ccc(C(NC(=O)N2CCCC3(COC3)C2)C(=O)Nc2ccc([Si](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C26H35N3O4Si/c1-32-21-10-6-19(7-11-21)23(24(30)27-20-8-12-22(13-9-20)34(2,3)4)28-25(31)29-15-5-14-26(16-29)17-33-18-26/h6-13,23H,5,14-18H2,1-4H3,(H,27,30)(H,28,31) |
| InChIKey | MMRNGGYINRSBFF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.67 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|