C25H34N2O4Si — CID 154406834
2-[[2-(1-hydroxycyclopentyl)acetyl]amino]-2-(4-methoxyphenyl)-N-(4-trimethylsilylphenyl)acetamide (PubChem CID 154406834) has the molecular formula C25H34N2O4Si and a molecular weight of 454.64 g/mol. Its IUPAC name is 2-[[2-(1-hydroxycyclopentyl)acetyl]amino]-2-(4-methoxyphenyl)-N-(4-trimethylsilylphenyl)acetamide.
| Compound Name | 2-[[2-(1-hydroxycyclopentyl)acetyl]amino]-2-(4-methoxyphenyl)-N-(4-trimethylsilylphenyl)acetamide |
|---|---|
| PubChem CID | 154406834 |
| Molecular Formula | C25H34N2O4Si |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 2-[[2-(1-hydroxycyclopentyl)acetyl]amino]-2-(4-methoxyphenyl)-N-(4-trimethylsilylphenyl)acetamide |
| SMILES | COc1ccc(C(NC(=O)CC2(O)CCCC2)C(=O)Nc2ccc([Si](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H34N2O4Si/c1-31-20-11-7-18(8-12-20)23(27-22(28)17-25(30)15-5-6-16-25)24(29)26-19-9-13-21(14-10-19)32(2,3)4/h7-14,23,30H,5-6,15-17H2,1-4H3,(H,26,29)(H,27,28) |
| InChIKey | IVZCGAPNSXJJRI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|